C7H8F8 — CID 90262453
2,2,3,3,4-pentafluoro-4-(trifluoromethyl)hexane (PubChem CID 90262453) has the molecular formula C7H8F8 and a molecular weight of 244.12 g/mol. Its IUPAC name is 2,2,3,3,4-pentafluoro-4-(trifluoromethyl)hexane.
| Compound Name | 2,2,3,3,4-pentafluoro-4-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 90262453 |
| Molecular Formula | C7H8F8 |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2,2,3,3,4-pentafluoro-4-(trifluoromethyl)hexane |
| SMILES | CCC(F)(C(F)(F)F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C7H8F8/c1-3-5(10,7(13,14)15)6(11,12)4(2,8)9/h3H2,1-2H3 |
| InChIKey | AGKZZCDCNGBCLV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|