C8H11F7 — CID 158342354
2,3,3,4-tetrafluoro-2-methyl-4-(trifluoromethyl)hexane (PubChem CID 158342354) has the molecular formula C8H11F7 and a molecular weight of 240.16 g/mol. Its IUPAC name is 2,3,3,4-tetrafluoro-2-methyl-4-(trifluoromethyl)hexane.
| Compound Name | 2,3,3,4-tetrafluoro-2-methyl-4-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 158342354 |
| Molecular Formula | C8H11F7 |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2,3,3,4-tetrafluoro-2-methyl-4-(trifluoromethyl)hexane |
| SMILES | CCC(F)(C(F)(F)F)C(F)(F)C(C)(C)F |
| InChI | InChI=1S/C8H11F7/c1-4-6(10,8(13,14)15)7(11,12)5(2,3)9/h4H2,1-3H3 |
| InChIKey | IGVDUDIBVJZGEF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |