C15H33N — CID 88947660
3-ethyl-2,2,3,4,5,5-hexamethylheptan-4-amine (PubChem CID 88947660) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is 3-ethyl-2,2,3,4,5,5-hexamethylheptan-4-amine.
| Compound Name | 3-ethyl-2,2,3,4,5,5-hexamethylheptan-4-amine |
|---|---|
| PubChem CID | 88947660 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 3-ethyl-2,2,3,4,5,5-hexamethylheptan-4-amine |
| SMILES | CCC(C)(C)C(C)(N)C(C)(CC)C(C)(C)C |
| InChI | InChI=1S/C15H33N/c1-10-13(6,7)15(9,16)14(8,11-2)12(3,4)5/h10-11,16H2,1-9H3 |
| InChIKey | VVTZFDUIOZQJGU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |