C13H24O2 — CID 10242299
3-ethoxy-2-(4-methylcyclohexyl)but-3-en-2-ol (PubChem CID 10242299) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 3-ethoxy-2-(4-methylcyclohexyl)but-3-en-2-ol.
| Compound Name | 3-ethoxy-2-(4-methylcyclohexyl)but-3-en-2-ol |
|---|---|
| PubChem CID | 10242299 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 3-ethoxy-2-(4-methylcyclohexyl)but-3-en-2-ol |
| SMILES | C=C(OCC)C(C)(O)C1CCC(C)CC1 |
| InChI | InChI=1S/C13H24O2/c1-5-15-11(3)13(4,14)12-8-6-10(2)7-9-12/h10,12,14H,3,5-9H2,1-2,4H3 |
| InChIKey | NYSROMTXZDPUJJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|