About ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine
ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine (PubChem CID 144515600) has the molecular formula C15H33N
and a molecular weight of 227.44 g/mol. Its IUPAC name is ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine.
Molecular Properties
| Compound Name | ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine |
| PubChem CID | 144515600 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine |
| SMILES | C=C.C=C(N)CCC.CCC(C)(CC)CC |
| InChI | InChI=1S/C8H18.C5H11N.C2H4/c1-5-8(4,6-2)7-3;1-3-4-5(2)6;1-2/h5-7H2,1-4H3;2-4,6H2,1H3;1-2H2 |
| InChIKey | SQQUQNIXLWOXRC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine?
The IUPAC name of ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine (CID 144515600) is ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine.
What is the SMILES notation for ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine?
The canonical SMILES for ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine is C=C.C=C(N)CCC.CCC(C)(CC)CC.
What is the InChIKey of ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine?
The InChIKey is SQQUQNIXLWOXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C5H11N.C2H4/c1-5-8(4,6-2)7-3;1-3-4-5(2)6;1-2/h5-7H2,1-4H3;2-4,6H2,1H3;1-2H2.
What are the key properties of ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine?
ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine has a molecular weight of 227.44 g/mol, XLogP of 5.28, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;3-ethyl-3-methylpentane;pent-1-en-2-amine is sourced from PubChem (CID 144515600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).