About heptadec-1-en-2-amine;molecular hydrogen
heptadec-1-en-2-amine;molecular hydrogen (PubChem CID 143986665) has the molecular formula C17H37N
and a molecular weight of 255.49 g/mol. Its IUPAC name is heptadec-1-en-2-amine;molecular hydrogen.
Molecular Properties
| Compound Name | heptadec-1-en-2-amine;molecular hydrogen |
| PubChem CID | 143986665 |
| Molecular Formula | C17H37N |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 255.29 |
| IUPAC Name | heptadec-1-en-2-amine;molecular hydrogen |
| SMILES | C=C(N)CCCCCCCCCCCCCCC.[H][H] |
| InChI | InChI=1S/C17H35N.H2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18;/h2-16,18H2,1H3;1H |
| InChIKey | VFUPMYJIANFJJL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptadec-1-en-2-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadec-1-en-2-amine;molecular hydrogen?
The IUPAC name of heptadec-1-en-2-amine;molecular hydrogen (CID 143986665) is heptadec-1-en-2-amine;molecular hydrogen.
What is the SMILES notation for heptadec-1-en-2-amine;molecular hydrogen?
The canonical SMILES for heptadec-1-en-2-amine;molecular hydrogen is C=C(N)CCCCCCCCCCCCCCC.[H][H].
What is the InChIKey of heptadec-1-en-2-amine;molecular hydrogen?
The InChIKey is VFUPMYJIANFJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35N.H2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18;/h2-16,18H2,1H3;1H.
What are the key properties of heptadec-1-en-2-amine;molecular hydrogen?
heptadec-1-en-2-amine;molecular hydrogen has a molecular weight of 255.49 g/mol, XLogP of 6.19, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptadec-1-en-2-amine;molecular hydrogen is sourced from PubChem (CID 143986665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).