About dodec-11-ene-1,11-diamine
dodec-11-ene-1,11-diamine (PubChem CID 88786698) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is dodec-11-ene-1,11-diamine.
Molecular Properties
| Compound Name | dodec-11-ene-1,11-diamine |
| PubChem CID | 88786698 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | dodec-11-ene-1,11-diamine |
| SMILES | C=C(N)CCCCCCCCCCN |
| InChI | InChI=1S/C12H26N2/c1-12(14)10-8-6-4-2-3-5-7-9-11-13/h1-11,13-14H2 |
| InChIKey | VORCNYIQNWJXIW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodec-11-ene-1,11-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-11-ene-1,11-diamine?
The IUPAC name of dodec-11-ene-1,11-diamine (CID 88786698) is dodec-11-ene-1,11-diamine.
What is the SMILES notation for dodec-11-ene-1,11-diamine?
The canonical SMILES for dodec-11-ene-1,11-diamine is C=C(N)CCCCCCCCCCN.
What is the InChIKey of dodec-11-ene-1,11-diamine?
The InChIKey is VORCNYIQNWJXIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-12(14)10-8-6-4-2-3-5-7-9-11-13/h1-11,13-14H2.
What are the key properties of dodec-11-ene-1,11-diamine?
dodec-11-ene-1,11-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.93, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-11-ene-1,11-diamine is sourced from PubChem (CID 88786698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).