C19H29N3O3S2 — CID 118328975
O-ethyl [5-cyano-5-methyl-1,3-bis(2-oxopyrrolidin-1-yl)hexyl]sulfanylmethanethioate (PubChem CID 118328975) has the molecular formula C19H29N3O3S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is O-ethyl [5-cyano-5-methyl-1,3-bis(2-oxopyrrolidin-1-yl)hexyl]sulfanylmethanethioate.
| Compound Name | O-ethyl [5-cyano-5-methyl-1,3-bis(2-oxopyrrolidin-1-yl)hexyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 118328975 |
| Molecular Formula | C19H29N3O3S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | O-ethyl [5-cyano-5-methyl-1,3-bis(2-oxopyrrolidin-1-yl)hexyl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CC(CC(C)(C)C#N)N1CCCC1=O)N1CCCC1=O |
| InChI | InChI=1S/C19H29N3O3S2/c1-4-25-18(26)27-17(22-10-6-8-16(22)24)11-14(12-19(2,3)13-20)21-9-5-7-15(21)23/h14,17H,4-12H2,1-3H3 |
| InChIKey | FEJILDBCFZEQOY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|