C11H22N2O2 — CID 154648377
2-(2-oxopyrrolidin-1-yl)butanamide;propane (PubChem CID 154648377) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-(2-oxopyrrolidin-1-yl)butanamide;propane.
| Compound Name | 2-(2-oxopyrrolidin-1-yl)butanamide;propane |
|---|---|
| PubChem CID | 154648377 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-(2-oxopyrrolidin-1-yl)butanamide;propane |
| SMILES | CCC.CCC(C(N)=O)N1CCCC1=O |
| InChI | InChI=1S/C8H14N2O2.C3H8/c1-2-6(8(9)12)10-5-3-4-7(10)11;1-3-2/h6H,2-5H2,1H3,(H2,9,12);3H2,1-2H3 |
| InChIKey | FXFJVNCVWYJSPX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |