C8H14N2O3 — CID 135817952
(2R)-N-hydroxy-2-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 135817952) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is (2R)-N-hydroxy-2-(2-oxopyrrolidin-1-yl)butanamide.
| Compound Name | (2R)-N-hydroxy-2-(2-oxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 135817952 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (2R)-N-hydroxy-2-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | CC[C@H](C(=O)NO)N1CCCC1=O |
| InChI | InChI=1S/C8H14N2O3/c1-2-6(8(12)9-13)10-5-3-4-7(10)11/h6,13H,2-5H2,1H3,(H,9,12)/t6-/m1/s1 |
| InChIKey | KHRUUPDURZBWHR-ZCFIWIBFSA-N |
| XLogP | -0.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|