C13H25N3O4S — CID 68508171
(2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 68508171) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-(2-oxopyrrolidin-1-yl)butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-(2-oxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 68508171 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | CC[C@@H](C(N)=O)N1CCCC1=O.CSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H14N2O2.C5H11NO2S/c1-2-6(8(9)12)10-5-3-4-7(10)11;1-9-3-2-4(6)5(7)8/h6H,2-5H2,1H3,(H2,9,12);4H,2-3,6H2,1H3,(H,7,8)/t6-;4-/m00/s1 |
| InChIKey | IHOWXNVSZMTSEW-FPAZSGHZSA-N |
| XLogP | 0.02 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |