C16H22N2O5 — CID 139145126
(2S)-2-hydroxy-2-phenylacetic acid;(2S)-2-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 139145126) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-phenylacetic acid;(2S)-2-(2-oxopyrrolidin-1-yl)butanamide.
| Compound Name | (2S)-2-hydroxy-2-phenylacetic acid;(2S)-2-(2-oxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 139145126 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2S)-2-hydroxy-2-phenylacetic acid;(2S)-2-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | CC[C@@H](C(N)=O)N1CCCC1=O.O=C(O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C8H14N2O2.C8H8O3/c1-2-6(8(9)12)10-5-3-4-7(10)11;9-7(8(10)11)6-4-2-1-3-5-6/h6H,2-5H2,1H3,(H2,9,12);1-5,7,9H,(H,10,11)/t6-;7-/m00/s1 |
| InChIKey | DKBIQGQVTYATBU-NMNGKWJYSA-N |
| XLogP | 0.68 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |