About methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide
methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide (PubChem CID 143300675) has the molecular formula C8H16N2O2S
and a molecular weight of 204.30 g/mol. Its IUPAC name is methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide.
Molecular Properties
| Compound Name | methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide |
| PubChem CID | 143300675 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide |
| SMILES | CS.C[C@@H](C(N)=O)N1CCCC1=O |
| InChI | InChI=1S/C7H12N2O2.CH4S/c1-5(7(8)11)9-4-2-3-6(9)10;1-2/h5H,2-4H2,1H3,(H2,8,11);2H,1H3/t5-;/m0./s1 |
| InChIKey | UTUQRWIHKAWIBN-JEDNCBNOSA-N |
| XLogP | 0.03 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide?
The IUPAC name of methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide (CID 143300675) is methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide.
What is the SMILES notation for methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide?
The canonical SMILES for methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide is CS.C[C@@H](C(N)=O)N1CCCC1=O.
What is the InChIKey of methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide?
The InChIKey is UTUQRWIHKAWIBN-JEDNCBNOSA-N. The full InChI is InChI=1S/C7H12N2O2.CH4S/c1-5(7(8)11)9-4-2-3-6(9)10;1-2/h5H,2-4H2,1H3,(H2,8,11);2H,1H3/t5-;/m0./s1.
What are the key properties of methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide?
methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide has a molecular weight of 204.30 g/mol, XLogP of 0.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;(2S)-2-(2-oxopyrrolidin-1-yl)propanamide is sourced from PubChem (CID 143300675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).