C14H25NO3 — CID 99802681
2,2-dimethylpropyl (3S)-3-(2-oxopiperidin-1-yl)butanoate (PubChem CID 99802681) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2,2-dimethylpropyl (3S)-3-(2-oxopiperidin-1-yl)butanoate.
| Compound Name | 2,2-dimethylpropyl (3S)-3-(2-oxopiperidin-1-yl)butanoate |
|---|---|
| PubChem CID | 99802681 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2,2-dimethylpropyl (3S)-3-(2-oxopiperidin-1-yl)butanoate |
| SMILES | C[C@@H](CC(=O)OCC(C)(C)C)N1CCCCC1=O |
| InChI | InChI=1S/C14H25NO3/c1-11(15-8-6-5-7-12(15)16)9-13(17)18-10-14(2,3)4/h11H,5-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | SAMGQFUQMGCTPO-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |