C11H20N2O2 — CID 177284463
2,2-dimethylpropyl 2-oxopiperidine-1-carboximidate (PubChem CID 177284463) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-oxopiperidine-1-carboximidate.
| Compound Name | 2,2-dimethylpropyl 2-oxopiperidine-1-carboximidate |
|---|---|
| PubChem CID | 177284463 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2,2-dimethylpropyl 2-oxopiperidine-1-carboximidate |
| SMILES | [H]/N=C(\OCC(C)(C)C)N1CCCCC1=O |
| InChI | InChI=1S/C11H20N2O2/c1-11(2,3)8-15-10(12)13-7-5-4-6-9(13)14/h12H,4-8H2,1-3H3/b12-10- |
| InChIKey | UMILDKPMIRQBLP-BENRWUELSA-N |
| XLogP | 2.00 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|