C9H14N2O2 — CID 70440707
2-(2-oxopyrrolidin-1-yl)pent-4-enamide (PubChem CID 70440707) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-(2-oxopyrrolidin-1-yl)pent-4-enamide.
| Compound Name | 2-(2-oxopyrrolidin-1-yl)pent-4-enamide |
|---|---|
| PubChem CID | 70440707 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-(2-oxopyrrolidin-1-yl)pent-4-enamide |
| SMILES | C=CCC(C(N)=O)N1CCCC1=O |
| InChI | InChI=1S/C9H14N2O2/c1-2-4-7(9(10)13)11-6-3-5-8(11)12/h2,7H,1,3-6H2,(H2,10,13) |
| InChIKey | HTBIUZIPCJYPDV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|