amino 2-(2-oxopyrrolidin-1-yl)pentanoate

C9H16N2O3 — CID 90161932

IUPACamino 2-(2-oxopyrrolidin-1-yl)pentanoate
SMILESCCCC(C(=O)ON)N1CCCC1=O
InChIInChI=1S/C9H16N2O3/c1-2-4-7(9(13)14-10)11-6-3-5-8(11)12/h7H,2-6,10H2,1H3
InChIKeyKNGZPASLGDAREB-UHFFFAOYSA-N
MW200.24 g/mol
LogP0.19
Rot. Bonds4

About amino 2-(2-oxopyrrolidin-1-yl)pentanoate

amino 2-(2-oxopyrrolidin-1-yl)pentanoate (PubChem CID 90161932) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is amino 2-(2-oxopyrrolidin-1-yl)pentanoate.

Molecular Properties

Compound Nameamino 2-(2-oxopyrrolidin-1-yl)pentanoate
PubChem CID90161932
Molecular FormulaC9H16N2O3
Molecular Weight200.24 g/mol
Exact Mass200.12
IUPAC Nameamino 2-(2-oxopyrrolidin-1-yl)pentanoate
SMILESCCCC(C(=O)ON)N1CCCC1=O
InChIInChI=1S/C9H16N2O3/c1-2-4-7(9(13)14-10)11-6-3-5-8(11)12/h7H,2-6,10H2,1H3
InChIKeyKNGZPASLGDAREB-UHFFFAOYSA-N
XLogP0.19
TPSA72.63 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.24
LogP ≤ 50.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 2-(2-oxopyrrolidin-1-yl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 2-(2-oxopyrrolidin-1-yl)pentanoate?
The IUPAC name of amino 2-(2-oxopyrrolidin-1-yl)pentanoate (CID 90161932) is amino 2-(2-oxopyrrolidin-1-yl)pentanoate.
What is the SMILES notation for amino 2-(2-oxopyrrolidin-1-yl)pentanoate?
The canonical SMILES for amino 2-(2-oxopyrrolidin-1-yl)pentanoate is CCCC(C(=O)ON)N1CCCC1=O.
What is the InChIKey of amino 2-(2-oxopyrrolidin-1-yl)pentanoate?
The InChIKey is KNGZPASLGDAREB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-2-4-7(9(13)14-10)11-6-3-5-8(11)12/h7H,2-6,10H2,1H3.
What are the key properties of amino 2-(2-oxopyrrolidin-1-yl)pentanoate?
amino 2-(2-oxopyrrolidin-1-yl)pentanoate has a molecular weight of 200.24 g/mol, XLogP of 0.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2-(2-oxopyrrolidin-1-yl)pentanoate is sourced from PubChem (CID 90161932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).