C16H21NO2 — CID 122202592
1-[1-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)hexan-2-yl]pyrrolidin-2-one (PubChem CID 122202592) has the molecular formula C16H21NO2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 1-[1-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)hexan-2-yl]pyrrolidin-2-one.
| Compound Name | 1-[1-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)hexan-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 122202592 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 1-[1-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)hexan-2-yl]pyrrolidin-2-one |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)C(CCCC)N2CCCC2=O)c([2H])c1[2H] |
| InChI | InChI=1S/C16H21NO2/c1-2-3-10-14(17-12-7-11-15(17)18)16(19)13-8-5-4-6-9-13/h4-6,8-9,14H,2-3,7,10-12H2,1H3/i4D,5D,6D,8D,9D |
| InChIKey | GAXQDPLHUOWKOL-SPUMIAEJSA-N |
| XLogP | 3.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |