C18H25NO4Si — CID 86069855
trimethylsilyl 4-[2-(2-oxopyrrolidin-1-yl)butanoyl]benzoate (PubChem CID 86069855) has the molecular formula C18H25NO4Si and a molecular weight of 347.49 g/mol. Its IUPAC name is trimethylsilyl 4-[2-(2-oxopyrrolidin-1-yl)butanoyl]benzoate.
| Compound Name | trimethylsilyl 4-[2-(2-oxopyrrolidin-1-yl)butanoyl]benzoate |
|---|---|
| PubChem CID | 86069855 |
| Molecular Formula | C18H25NO4Si |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | trimethylsilyl 4-[2-(2-oxopyrrolidin-1-yl)butanoyl]benzoate |
| SMILES | CCC(C(=O)c1ccc(C(=O)O[Si](C)(C)C)cc1)N1CCCC1=O |
| InChI | InChI=1S/C18H25NO4Si/c1-5-15(19-12-6-7-16(19)20)17(21)13-8-10-14(11-9-13)18(22)23-24(2,3)4/h8-11,15H,5-7,12H2,1-4H3 |
| InChIKey | OPWTYDXWQFENCU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|