C14H29NO — CID 142297493
1-(5,5-dimethylhexan-3-yl)pyrrolidin-2-one;ethane (PubChem CID 142297493) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 1-(5,5-dimethylhexan-3-yl)pyrrolidin-2-one;ethane.
| Compound Name | 1-(5,5-dimethylhexan-3-yl)pyrrolidin-2-one;ethane |
|---|---|
| PubChem CID | 142297493 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 1-(5,5-dimethylhexan-3-yl)pyrrolidin-2-one;ethane |
| SMILES | CC.CCC(CC(C)(C)C)N1CCCC1=O |
| InChI | InChI=1S/C12H23NO.C2H6/c1-5-10(9-12(2,3)4)13-8-6-7-11(13)14;1-2/h10H,5-9H2,1-4H3;1-2H3 |
| InChIKey | FTAUEXMLQHCQBZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |