C17H33N2O3+ — CID 58611503
2-[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]oxyethyl-trimethylazanium (PubChem CID 58611503) has the molecular formula C17H33N2O3+ and a molecular weight of 313.46 g/mol. Its IUPAC name is 2-[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 58611503 |
| Molecular Formula | C17H33N2O3+ |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 2-[2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)hexanoyl]oxyethyl-trimethylazanium |
| SMILES | CCC(CC(C)(C)C(=O)OCC[N+](C)(C)C)N1CCCC1=O |
| InChI | InChI=1S/C17H33N2O3/c1-7-14(18-10-8-9-15(18)20)13-17(2,3)16(21)22-12-11-19(4,5)6/h14H,7-13H2,1-6H3/q+1 |
| InChIKey | BWXZDOKLIWCRDX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|