C8H15NOS2 — CID 123282095
1-[1,2-bis(methylsulfanyl)ethyl]pyrrolidin-2-one (PubChem CID 123282095) has the molecular formula C8H15NOS2 and a molecular weight of 205.35 g/mol. Its IUPAC name is 1-[1,2-bis(methylsulfanyl)ethyl]pyrrolidin-2-one.
| Compound Name | 1-[1,2-bis(methylsulfanyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123282095 |
| Molecular Formula | C8H15NOS2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 1-[1,2-bis(methylsulfanyl)ethyl]pyrrolidin-2-one |
| SMILES | CSCC(SC)N1CCCC1=O |
| InChI | InChI=1S/C8H15NOS2/c1-11-6-8(12-2)9-5-3-4-7(9)10/h8H,3-6H2,1-2H3 |
| InChIKey | WMMUYPVAMCKDKW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |