C6H13NOP2 — CID 131751496
1-[1,2-bis(phosphanyl)ethyl]pyrrolidin-2-one (PubChem CID 131751496) has the molecular formula C6H13NOP2 and a molecular weight of 177.12 g/mol. Its IUPAC name is 1-[1,2-bis(phosphanyl)ethyl]pyrrolidin-2-one.
| Compound Name | 1-[1,2-bis(phosphanyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 131751496 |
| Molecular Formula | C6H13NOP2 |
| Molecular Weight | 177.12 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 1-[1,2-bis(phosphanyl)ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C(P)CP |
| InChI | InChI=1S/C6H13NOP2/c8-5-2-1-3-7(5)6(10)4-9/h6H,1-4,9-10H2 |
| InChIKey | LQIAZOCLNBBZQK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.12 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|