C19H40O5S2Si2 — CID 59620828
2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 2-ethoxycarbothioylsulfanylpropanoate (PubChem CID 59620828) has the molecular formula C19H40O5S2Si2 and a molecular weight of 468.83 g/mol. Its IUPAC name is 2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 2-ethoxycarbothioylsulfanylpropanoate.
| Compound Name | 2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 2-ethoxycarbothioylsulfanylpropanoate |
|---|---|
| PubChem CID | 59620828 |
| Molecular Formula | C19H40O5S2Si2 |
| Molecular Weight | 468.83 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 2-ethoxycarbothioylsulfanylpropanoate |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CCCOCCOC(=O)C(C)SC(=S)OCC |
| InChI | InChI=1S/C19H40O5S2Si2/c1-8-10-15-27(4,5)24-28(6,7)16-11-12-21-13-14-23-18(20)17(3)26-19(25)22-9-2/h17H,8-16H2,1-7H3 |
| InChIKey | GFSZKEHILPQGKV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.83 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|