C28H56O7S2Si5 — CID 58507664
3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 4-(ethoxycarbothioylsulfanylmethyl)benzoate (PubChem CID 58507664) has the molecular formula C28H56O7S2Si5 and a molecular weight of 709.31 g/mol. Its IUPAC name is 3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 4-(ethoxycarbothioylsulfanylmethyl)benzoate.
| Compound Name | 3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 4-(ethoxycarbothioylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 58507664 |
| Molecular Formula | C28H56O7S2Si5 |
| Molecular Weight | 709.31 g/mol |
| Exact Mass | 708.23 |
| IUPAC Name | 3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 4-(ethoxycarbothioylsulfanylmethyl)benzoate |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCOC(=O)c1ccc(CSC(=S)OCC)cc1 |
| InChI | InChI=1S/C28H56O7S2Si5/c1-13-15-22-38(3,4)32-40(7,8)34-42(11,12)35-41(9,10)33-39(5,6)23-16-21-31-27(29)26-19-17-25(18-20-26)24-37-28(36)30-14-2/h17-20H,13-16,21-24H2,1-12H3 |
| InChIKey | OZRAGMKPVZHMQP-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.31 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|