C29H58O7Si3 — CID 159715562
1-[3-[[[butyl(dimethyl)silyl]methoxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]propan-1-ol;2-methoxyethyl 4-ethylbenzoate (PubChem CID 159715562) has the molecular formula C29H58O7Si3 and a molecular weight of 603.03 g/mol. Its IUPAC name is 1-[3-[[[butyl(dimethyl)silyl]methoxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]propan-1-ol;2-methoxyethyl 4-ethylbenzoate.
| Compound Name | 1-[3-[[[butyl(dimethyl)silyl]methoxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]propan-1-ol;2-methoxyethyl 4-ethylbenzoate |
|---|---|
| PubChem CID | 159715562 |
| Molecular Formula | C29H58O7Si3 |
| Molecular Weight | 603.03 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | 1-[3-[[[butyl(dimethyl)silyl]methoxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]propan-1-ol;2-methoxyethyl 4-ethylbenzoate |
| SMILES | CCCC[Si](C)(C)CO[Si](C)(C)O[Si](C)(C)CCCOC(O)CC.CCc1ccc(C(=O)OCCOC)cc1 |
| InChI | InChI=1S/C17H42O4Si3.C12H16O3/c1-9-11-14-22(3,4)16-20-24(7,8)21-23(5,6)15-12-13-19-17(18)10-2;1-3-10-4-6-11(7-5-10)12(13)15-9-8-14-2/h17-18H,9-16H2,1-8H3;4-7H,3,8-9H2,1-2H3 |
| InChIKey | MZJPIGJCHBNXOF-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.03 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|