About CID 174427975
CID 174427975 (PubChem CID 174427975) has the molecular formula C10H22O2S6
and a molecular weight of 366.69 g/mol.
Molecular Properties
| Compound Name | CID 174427975 |
| PubChem CID | 174427975 |
| Molecular Formula | C10H22O2S6 |
| Molecular Weight | 366.69 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | — |
| SMILES | CCOC(=S)SCC.CCOC(=S)SCC.SS |
| InChI | InChI=1S/2C5H10OS2.H2S2/c2*1-3-6-5(7)8-4-2;1-2/h2*3-4H2,1-2H3;1-2H |
| InChIKey | SCAJWXQQLKIFBI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.69 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174427975 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174427975?
The IUPAC name of CID 174427975 (CID 174427975) is not available.
What is the SMILES notation for CID 174427975?
The canonical SMILES for CID 174427975 is CCOC(=S)SCC.CCOC(=S)SCC.SS.
What is the InChIKey of CID 174427975?
The InChIKey is SCAJWXQQLKIFBI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H10OS2.H2S2/c2*1-3-6-5(7)8-4-2;1-2/h2*3-4H2,1-2H3;1-2H.
What are the key properties of CID 174427975?
CID 174427975 has a molecular weight of 366.69 g/mol, XLogP of 4.88, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174427975 is sourced from PubChem (CID 174427975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).