About bis(ethoxymethanedithioic acid);ruthenium(2+)
bis(ethoxymethanedithioic acid);ruthenium(2+) (PubChem CID 50910321) has the molecular formula C6H12O2RuS4+2
and a molecular weight of 345.50 g/mol. Its IUPAC name is bis(ethoxymethanedithioic acid);ruthenium(2+).
Molecular Properties
| Compound Name | bis(ethoxymethanedithioic acid);ruthenium(2+) |
| PubChem CID | 50910321 |
| Molecular Formula | C6H12O2RuS4+2 |
| Molecular Weight | 345.50 g/mol |
| Exact Mass | 345.88 |
| IUPAC Name | bis(ethoxymethanedithioic acid);ruthenium(2+) |
| SMILES | CCOC(=S)S.CCOC(=S)S.[Ru+2] |
| InChI | InChI=1S/2C3H6OS2.Ru/c2*1-2-4-3(5)6;/h2*2H2,1H3,(H,5,6);/q;;+2 |
| InChIKey | BUPRGBCWWTYIMR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(ethoxymethanedithioic acid);ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethoxymethanedithioic acid);ruthenium(2+)?
The IUPAC name of bis(ethoxymethanedithioic acid);ruthenium(2+) (CID 50910321) is bis(ethoxymethanedithioic acid);ruthenium(2+).
What is the SMILES notation for bis(ethoxymethanedithioic acid);ruthenium(2+)?
The canonical SMILES for bis(ethoxymethanedithioic acid);ruthenium(2+) is CCOC(=S)S.CCOC(=S)S.[Ru+2].
What is the InChIKey of bis(ethoxymethanedithioic acid);ruthenium(2+)?
The InChIKey is BUPRGBCWWTYIMR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H6OS2.Ru/c2*1-2-4-3(5)6;/h2*2H2,1H3,(H,5,6);/q;;+2.
What are the key properties of bis(ethoxymethanedithioic acid);ruthenium(2+)?
bis(ethoxymethanedithioic acid);ruthenium(2+) has a molecular weight of 345.50 g/mol, XLogP of 2.47, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethoxymethanedithioic acid);ruthenium(2+) is sourced from PubChem (CID 50910321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).