C11H21NO2S2 — CID 87182344
ethoxymethanedithioic acid;8-methyl-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 87182344) has the molecular formula C11H21NO2S2 and a molecular weight of 263.43 g/mol. Its IUPAC name is ethoxymethanedithioic acid;8-methyl-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | ethoxymethanedithioic acid;8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 87182344 |
| Molecular Formula | C11H21NO2S2 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | ethoxymethanedithioic acid;8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CCOC(=S)S.CN1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C8H15NO.C3H6OS2/c1-9-6-2-3-7(9)5-8(10)4-6;1-2-4-3(5)6/h6-8,10H,2-5H2,1H3;2H2,1H3,(H,5,6) |
| InChIKey | ICZFIYGBVMZLFQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|