C12H21NO2 — CID 63763771
1-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)pentan-1-one (PubChem CID 63763771) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)pentan-1-one.
| Compound Name | 1-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)pentan-1-one |
|---|---|
| PubChem CID | 63763771 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)pentan-1-one |
| SMILES | CCCCC(=O)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C12H21NO2/c1-2-3-4-12(15)13-9-5-6-10(13)8-11(14)7-9/h9-11,14H,2-8H2,1H3 |
| InChIKey | XSHAZAOPHMCWTI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |