C8H14N2O2 — CID 141143444
(1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 141143444) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | (1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 141143444 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | NC(=O)N1[C@H]2CC[C@H]1CC(O)C2 |
| InChI | InChI=1S/C8H14N2O2/c9-8(12)10-5-1-2-6(10)4-7(11)3-5/h5-7,11H,1-4H2,(H2,9,12)/t5-,6-/m0/s1 |
| InChIKey | UAUSQNHMIRQGPY-WDSKDSINSA-N |
| XLogP | 0.05 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |