C5H5BrF5NO — CID 140586139
N-(1-bromo-2,2,3,3,3-pentafluoropropyl)acetamide (PubChem CID 140586139) has the molecular formula C5H5BrF5NO and a molecular weight of 270.00 g/mol. Its IUPAC name is N-(1-bromo-2,2,3,3,3-pentafluoropropyl)acetamide.
| Compound Name | N-(1-bromo-2,2,3,3,3-pentafluoropropyl)acetamide |
|---|---|
| PubChem CID | 140586139 |
| Molecular Formula | C5H5BrF5NO |
| Molecular Weight | 270.00 g/mol |
| Exact Mass | 268.95 |
| IUPAC Name | N-(1-bromo-2,2,3,3,3-pentafluoropropyl)acetamide |
| SMILES | CC(=O)NC(Br)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H5BrF5NO/c1-2(13)12-3(6)4(7,8)5(9,10)11/h3H,1H3,(H,12,13) |
| InChIKey | JRTLFEMORNREMK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.00 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|