C12H18 — CID 91175342
2,5-dimethyl-3-prop-1-en-2-ylhepta-1,3,5-triene (PubChem CID 91175342) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 2,5-dimethyl-3-prop-1-en-2-ylhepta-1,3,5-triene.
| Compound Name | 2,5-dimethyl-3-prop-1-en-2-ylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 91175342 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 2,5-dimethyl-3-prop-1-en-2-ylhepta-1,3,5-triene |
| SMILES | C=C(C)C(=CC(C)=CC)C(=C)C |
| InChI | InChI=1S/C12H18/c1-7-11(6)8-12(9(2)3)10(4)5/h7-8H,2,4H2,1,3,5-6H3 |
| InChIKey | DLZCAEHYGBUWNJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|