C7H11Br — CID 76702782
2-bromo-4-methylhexa-2,4-diene (PubChem CID 76702782) has the molecular formula C7H11Br and a molecular weight of 175.07 g/mol. Its IUPAC name is 2-bromo-4-methylhexa-2,4-diene.
| Compound Name | 2-bromo-4-methylhexa-2,4-diene |
|---|---|
| PubChem CID | 76702782 |
| Molecular Formula | C7H11Br |
| Molecular Weight | 175.07 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | 2-bromo-4-methylhexa-2,4-diene |
| SMILES | CC=C(C)C=C(C)Br |
| InChI | InChI=1S/C7H11Br/c1-4-6(2)5-7(3)8/h4-5H,1-3H3 |
| InChIKey | HZYJTTIJKAEDEW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.07 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|