C7H9BrW — CID 58066334
[(2E)-2-bromo-4-methylhexa-2,4-dienylidene]tungsten (PubChem CID 58066334) has the molecular formula C7H9BrW and a molecular weight of 356.89 g/mol. Its IUPAC name is [(2E)-2-bromo-4-methylhexa-2,4-dienylidene]tungsten.
| Compound Name | [(2E)-2-bromo-4-methylhexa-2,4-dienylidene]tungsten |
|---|---|
| PubChem CID | 58066334 |
| Molecular Formula | C7H9BrW |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | [(2E)-2-bromo-4-methylhexa-2,4-dienylidene]tungsten |
| SMILES | CC=C(C)/C=C(/Br)C=[W] |
| InChI | InChI=1S/C7H9Br.W/c1-4-6(2)5-7(3)8;/h3-5H,1-2H3;/b6-4?,7-5+; |
| InChIKey | FPMBFXCYHCYSDL-BCZCZIRLSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|