C8H9BrO2 — CID 146176919
(2Z,5E)-5-bromo-2-methyl-4-oxohepta-2,5-dienal (PubChem CID 146176919) has the molecular formula C8H9BrO2 and a molecular weight of 217.06 g/mol. Its IUPAC name is (2Z,5E)-5-bromo-2-methyl-4-oxohepta-2,5-dienal.
| Compound Name | (2Z,5E)-5-bromo-2-methyl-4-oxohepta-2,5-dienal |
|---|---|
| PubChem CID | 146176919 |
| Molecular Formula | C8H9BrO2 |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | (2Z,5E)-5-bromo-2-methyl-4-oxohepta-2,5-dienal |
| SMILES | C/C=C(/Br)C(=O)/C=C(/C)C=O |
| InChI | InChI=1S/C8H9BrO2/c1-3-7(9)8(11)4-6(2)5-10/h3-5H,1-2H3/b6-4-,7-3+ |
| InChIKey | FYMKFPNNJUWBHF-STCZGFOLSA-N |
| XLogP | 2.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|