C7H12O2 — CID 174371366
4-methylhexa-2,4-diene-1,2-diol (PubChem CID 174371366) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 4-methylhexa-2,4-diene-1,2-diol.
| Compound Name | 4-methylhexa-2,4-diene-1,2-diol |
|---|---|
| PubChem CID | 174371366 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 4-methylhexa-2,4-diene-1,2-diol |
| SMILES | CC=C(C)C=C(O)CO |
| InChI | InChI=1S/C7H12O2/c1-3-6(2)4-7(9)5-8/h3-4,8-9H,5H2,1-2H3 |
| InChIKey | FUFOIYJCLRJSLE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|