C11H20O2 — CID 142246390
ethane;[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]oxymethanol (PubChem CID 142246390) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is ethane;[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]oxymethanol.
| Compound Name | ethane;[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]oxymethanol |
|---|---|
| PubChem CID | 142246390 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | ethane;[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]oxymethanol |
| SMILES | C=C/C(=C\C(C)=C/C)OCO.CC |
| InChI | InChI=1S/C9H14O2.C2H6/c1-4-8(3)6-9(5-2)11-7-10;1-2/h4-6,10H,2,7H2,1,3H3;1-2H3/b8-4-,9-6+; |
| InChIKey | SPUMNXDFAAGCIA-IMQWIENCSA-N |
| XLogP | 3.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|