C12H22O3 — CID 144746552
ethane;3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]oxypropane-1,2-diol (PubChem CID 144746552) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is ethane;3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]oxypropane-1,2-diol.
| Compound Name | ethane;3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]oxypropane-1,2-diol |
|---|---|
| PubChem CID | 144746552 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | ethane;3-[(3E)-5-methylhexa-1,3,5-trien-3-yl]oxypropane-1,2-diol |
| SMILES | C=C/C(=C\C(=C)C)OCC(O)CO.CC |
| InChI | InChI=1S/C10H16O3.C2H6/c1-4-10(5-8(2)3)13-7-9(12)6-11;1-2/h4-5,9,11-12H,1-2,6-7H2,3H3;1-2H3/b10-5+; |
| InChIKey | REQNANSNEDXIFI-OAZHBLANSA-N |
| XLogP | 2.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|