C8H18ClNO3 — CID 87816796
2,3-dihydroxypropoxy-dimethyl-prop-2-enylazanium chloride (PubChem CID 87816796) has the molecular formula C8H18ClNO3 and a molecular weight of 211.69 g/mol. Its IUPAC name is 2,3-dihydroxypropoxy-dimethyl-prop-2-enylazanium chloride.
| Compound Name | 2,3-dihydroxypropoxy-dimethyl-prop-2-enylazanium chloride |
|---|---|
| PubChem CID | 87816796 |
| Molecular Formula | C8H18ClNO3 |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2,3-dihydroxypropoxy-dimethyl-prop-2-enylazanium chloride |
| SMILES | C=CC[N+](C)(C)OCC(O)CO.[Cl-] |
| InChI | InChI=1S/C8H18NO3.ClH/c1-4-5-9(2,3)12-7-8(11)6-10;/h4,8,10-11H,1,5-7H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | FEXMMTPLBGYJOO-UHFFFAOYSA-M |
| XLogP | -3.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|