C9H20O6 — CID 174423077
dimethoxymethane;3-prop-2-enylperoxypropane-1,2-diol (PubChem CID 174423077) has the molecular formula C9H20O6 and a molecular weight of 224.25 g/mol. Its IUPAC name is dimethoxymethane;3-prop-2-enylperoxypropane-1,2-diol.
| Compound Name | dimethoxymethane;3-prop-2-enylperoxypropane-1,2-diol |
|---|---|
| PubChem CID | 174423077 |
| Molecular Formula | C9H20O6 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | dimethoxymethane;3-prop-2-enylperoxypropane-1,2-diol |
| SMILES | C=CCOOCC(O)CO.COCOC |
| InChI | InChI=1S/C6H12O4.C3H8O2/c1-2-3-9-10-5-6(8)4-7;1-4-3-5-2/h2,6-8H,1,3-5H2;3H2,1-2H3 |
| InChIKey | KDTSZYDXBKUHSO-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|