C12H28O3Si2 — CID 87616479
3-[1,1-bis(trimethylsilyl)prop-2-enoxy]propane-1,2-diol (PubChem CID 87616479) has the molecular formula C12H28O3Si2 and a molecular weight of 276.52 g/mol. Its IUPAC name is 3-[1,1-bis(trimethylsilyl)prop-2-enoxy]propane-1,2-diol.
| Compound Name | 3-[1,1-bis(trimethylsilyl)prop-2-enoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 87616479 |
| Molecular Formula | C12H28O3Si2 |
| Molecular Weight | 276.52 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-[1,1-bis(trimethylsilyl)prop-2-enoxy]propane-1,2-diol |
| SMILES | C=CC(OCC(O)CO)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H28O3Si2/c1-8-12(16(2,3)4,17(5,6)7)15-10-11(14)9-13/h8,11,13-14H,1,9-10H2,2-7H3 |
| InChIKey | ZULYXWVQMLHCOY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|