C11H22O11 — CID 88705292
2,2,2-tris(2,3-dihydroxypropoxy)acetic acid (PubChem CID 88705292) has the molecular formula C11H22O11 and a molecular weight of 330.29 g/mol. Its IUPAC name is 2,2,2-tris(2,3-dihydroxypropoxy)acetic acid.
| Compound Name | 2,2,2-tris(2,3-dihydroxypropoxy)acetic acid |
|---|---|
| PubChem CID | 88705292 |
| Molecular Formula | C11H22O11 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2,2,2-tris(2,3-dihydroxypropoxy)acetic acid |
| SMILES | O=C(O)C(OCC(O)CO)(OCC(O)CO)OCC(O)CO |
| InChI | InChI=1S/C11H22O11/c12-1-7(15)4-20-11(10(18)19,21-5-8(16)2-13)22-6-9(17)3-14/h7-9,12-17H,1-6H2,(H,18,19) |
| InChIKey | AFMSXJOQDOWZDP-UHFFFAOYSA-N |
| XLogP | -4.17 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|