C10H18O10 — CID 174626088
2,3-bis(2,3-dihydroxypropoxy)butanedioic acid (PubChem CID 174626088) has the molecular formula C10H18O10 and a molecular weight of 298.24 g/mol. Its IUPAC name is 2,3-bis(2,3-dihydroxypropoxy)butanedioic acid.
| Compound Name | 2,3-bis(2,3-dihydroxypropoxy)butanedioic acid |
|---|---|
| PubChem CID | 174626088 |
| Molecular Formula | C10H18O10 |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2,3-bis(2,3-dihydroxypropoxy)butanedioic acid |
| SMILES | O=C(O)C(OCC(O)CO)C(OCC(O)CO)C(=O)O |
| InChI | InChI=1S/C10H18O10/c11-1-5(13)3-19-7(9(15)16)8(10(17)18)20-4-6(14)2-12/h5-8,11-14H,1-4H2,(H,15,16)(H,17,18) |
| InChIKey | CCTQYWVATXUQPW-UHFFFAOYSA-N |
| XLogP | -3.37 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |