C6H12O5 — CID 174650131
1-[(2S)-2,3-dihydroxypropoxy]-1-hydroxypropan-2-one (PubChem CID 174650131) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is 1-[(2S)-2,3-dihydroxypropoxy]-1-hydroxypropan-2-one.
| Compound Name | 1-[(2S)-2,3-dihydroxypropoxy]-1-hydroxypropan-2-one |
|---|---|
| PubChem CID | 174650131 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 1-[(2S)-2,3-dihydroxypropoxy]-1-hydroxypropan-2-one |
| SMILES | CC(=O)C(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C6H12O5/c1-4(8)6(10)11-3-5(9)2-7/h5-7,9-10H,2-3H2,1H3/t5-,6?/m0/s1 |
| InChIKey | DZDUJPOMXMJFMA-ZBHICJROSA-N |
| XLogP | -1.74 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|