C9H18O3 — CID 173222430
3-(3-methylpent-3-en-2-yloxy)propane-1,2-diol (PubChem CID 173222430) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-(3-methylpent-3-en-2-yloxy)propane-1,2-diol.
| Compound Name | 3-(3-methylpent-3-en-2-yloxy)propane-1,2-diol |
|---|---|
| PubChem CID | 173222430 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 3-(3-methylpent-3-en-2-yloxy)propane-1,2-diol |
| SMILES | CC=C(C)C(C)OCC(O)CO |
| InChI | InChI=1S/C9H18O3/c1-4-7(2)8(3)12-6-9(11)5-10/h4,8-11H,5-6H2,1-3H3 |
| InChIKey | MJAMFTMOEHEDDJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|