C11H22O4 — CID 174900159
3-(2-hydroxy-2,5-dimethylhex-4-en-3-yl)oxypropane-1,2-diol (PubChem CID 174900159) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is 3-(2-hydroxy-2,5-dimethylhex-4-en-3-yl)oxypropane-1,2-diol.
| Compound Name | 3-(2-hydroxy-2,5-dimethylhex-4-en-3-yl)oxypropane-1,2-diol |
|---|---|
| PubChem CID | 174900159 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-(2-hydroxy-2,5-dimethylhex-4-en-3-yl)oxypropane-1,2-diol |
| SMILES | CC(C)=CC(OCC(O)CO)C(C)(C)O |
| InChI | InChI=1S/C11H22O4/c1-8(2)5-10(11(3,4)14)15-7-9(13)6-12/h5,9-10,12-14H,6-7H2,1-4H3 |
| InChIKey | MIPSGZDAXCVVNT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|