C7H14O4 — CID 91071629
3-(1-hydroxybut-2-enoxy)propane-1,2-diol (PubChem CID 91071629) has the molecular formula C7H14O4 and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-(1-hydroxybut-2-enoxy)propane-1,2-diol.
| Compound Name | 3-(1-hydroxybut-2-enoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 91071629 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-(1-hydroxybut-2-enoxy)propane-1,2-diol |
| SMILES | CC=CC(O)OCC(O)CO |
| InChI | InChI=1S/C7H14O4/c1-2-3-7(10)11-5-6(9)4-8/h2-3,6-10H,4-5H2,1H3 |
| InChIKey | DVSNAPPAYDKDAG-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|