C18H38O6 — CID 23193769
3-[1-(2,3-dihydroxypropoxy)dodecoxy]propane-1,2-diol (PubChem CID 23193769) has the molecular formula C18H38O6 and a molecular weight of 350.50 g/mol. Its IUPAC name is 3-[1-(2,3-dihydroxypropoxy)dodecoxy]propane-1,2-diol.
| Compound Name | 3-[1-(2,3-dihydroxypropoxy)dodecoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 23193769 |
| Molecular Formula | C18H38O6 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 3-[1-(2,3-dihydroxypropoxy)dodecoxy]propane-1,2-diol |
| SMILES | CCCCCCCCCCCC(OCC(O)CO)OCC(O)CO |
| InChI | InChI=1S/C18H38O6/c1-2-3-4-5-6-7-8-9-10-11-18(23-14-16(21)12-19)24-15-17(22)13-20/h16-22H,2-15H2,1H3 |
| InChIKey | GLOHRFKSCVUZCR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|