C6H12O3 — CID 131246750
(2R)-3-[(E)-prop-1-enoxy]propane-1,2-diol (PubChem CID 131246750) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (2R)-3-[(E)-prop-1-enoxy]propane-1,2-diol.
| Compound Name | (2R)-3-[(E)-prop-1-enoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 131246750 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (2R)-3-[(E)-prop-1-enoxy]propane-1,2-diol |
| SMILES | C/C=C/OC[C@H](O)CO |
| InChI | InChI=1S/C6H12O3/c1-2-3-9-5-6(8)4-7/h2-3,6-8H,4-5H2,1H3/b3-2+/t6-/m1/s1 |
| InChIKey | CRZYFVPBJDWHEX-YRFDSLTASA-N |
| XLogP | -0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|